Boronic acid derivatives
Matrix Scientific 3-METHOXYPHENYLBORONIC ACI-25G
3-Methoxyphenylboronic acid, 97%; 25g,C7H9BO3, MFCD00161359, mw 151.96, [10365-98-7]
Cambridge Isotope Laboratories Dioxin Furan Food/Feed/QQQ Calibration Standard (CS3) 0 25 mL
Dioxin Furan Food/Feed/QQQ Calibration Standard (CS3) 0 25 mL
Medchemexpress LLC Butylboronic acid | 4426-47-5 | 101.94 | 5 G
Butylboronic acid is a competitive soybean urease inhibitor with an IC50 of 2.9 mM and a Ki of 1.5 mM. It exerts its inhibitory effect on soybean (Glycine max) urease through a competitive inhibition mechanism. Additionally, it promotes cell proliferation, alkaline phosphatase activity, and expression of GJA1, ALP, and NaBC1 in human dental pulp cells in vitro. This product is intended for research use only.
- Competitive soybean urease inhibitor
- IC50 of 2.9 mM (soybean (Glycine max) urease)
- Ki of 1.5 mM
- Promotes cell proliferation in human dental pulp cells
- Enhances alkaline phosphatase activity
- Increases expression of GJA1, ALP, and NaBC1
eMolecules 363186-06-5 | Ambeed | Benzyl (4-(4455-tetramethyl-132-dioxaborolan-2-yl)phenyl)carbamate | 250mg | 696732229 | A624940 | MFCD02179440 | 353.23 | C20H24BNO4
ChemScene | 3-Chloro-4-(1h-imidazol-1-yl)aniline | 1g | 714159759 | CS-0268910 | 869942-76-7 | MFCD04971002 | 193.630 | C9H8ClN3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 126747-14-6 | 4-Cyanobenzeneboronic acid | Oakwood Chemicals | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 25g | 480110050
4-Cyanobenzeneboronic acid | Oakwood Chemicals | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 25g | 480110050
Chemscene ChemScene | (2-Hydroxypyrimidin-5-yl)boronic acid | 5G | CS-0174146 | 0.98 | 373384-19-1| MFCD08275734 | 139.91
ChemScene | (2-Hydroxypyrimidin-5-yl)boronic acid | 5G | CS-0174146 | 0.98 | 373384-19-1| MFCD08275734 | 139.91
eMolecules 126747-14-6 | 4-Cyanophenylboronic acid | Combi-Blocks | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 5g | 117520817
4-Cyanophenylboronic acid | Combi-Blocks | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 5g | 117520817
eMolecules 238088-16-9 | 3-CYANO-1-PROPYLBORONIC ACID PINACOL ESTER | AstaTech | MFCD09953480 | 195.070 | C10H18BNO2 | 95.000 | CC1(C)OB(CCCC#N)OC1(C)C | 0.25g | 718060567
3-CYANO-1-PROPYLBORONIC ACID PINACOL ESTER | AstaTech | 238088-16-9 | MFCD09953480 | 195.070 | C10H18BNO2 | 95.000 | CC1(C)OB(CCCC#N)OC1(C)C | 0.25g | 718060567
eMolecules 571-57-3 | 4-Bromonaphthalen-1-ol | Ambeed | MFCD03129265 | 223.069 | C10H7BrO | 97.000 | Oc1ccc(Br)c2ccccc12 | 250mg | 490550596
4-Bromonaphthalen-1-ol | Ambeed | 571-57-3 | MFCD03129265 | 223.069 | C10H7BrO | 97.000 | Oc1ccc(Br)c2ccccc12 | 250mg | 490550596
Accela Chembio Inc MF: C7H9O2B | MW: 135.96 | >97% | Flash Point: 61.6? | BP: 275.2? at 760 mmHg.
MF: C7H9O2B | MW: 135.96 | >97% | Flash Point: 61.6? | BP: 275.2? at 760 mmHg.
eMolecules 2640480-55-1 | Ambeed | 24-Bis(benzyloxy)-5-(4455-tetramethyl-132-dioxaborolan-2-yl)pyrimidine | 100mg | 752810304 | A1684313 | MFCD28399193 | 418.3 | C24H27BN2O4
Ambeed | 2-Naphthalenesulfinic acid sodium salt | 250mg | 672522711 | A1125765 | 63735-42-2 | MFCD11618060 | 214.210 | C10H7NaO2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 1150114-77-4 | Ambeed | 4-Cyano-2-fluorophenylboronic Acid | 250mg | 586032690 | A464605 | MFCD07644472 | 164.93 | C7H5BFNO2
Pharmablock | ethyl 6-methyl-5-nitropyridine-3-carboxylate | 25mg | 551211004 | PB06253 | 1211538-09-8 | MFCD18260802 | 210.189 | C9H10N2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 66088-45-7 | 2-Amino-4-(2-fluorophenylamino)-1,3,5-triazine | Oakwood Chemical | MFCD00052347 | 205.196 | C9H8FN5 | 97.000 | Nc1ncnc(Nc2ccccc2F)n1 | 500mg | 537665219
2-Amino-4-(2-fluorophenylamino)-1,3,5-triazine | Oakwood Chemical | 66088-45-7 | MFCD00052347 | 205.196 | C9H8FN5 | 97.000 | Nc1ncnc(Nc2ccccc2F)n1 | 500mg | 537665219
eMolecules 1-(Phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole | AmbeedMFCD31418890 | 383.270 | C20H22BNO4S | 95.000 | CC1(C)OB(OC1(C)C)c1cc2ccccc2n1S(=O)(=O)c1ccccc1 | 100mg | 742299535
1-(Phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole | AmbeedMFCD31418890 | 383.270 | C20H22BNO4S | 95.000 | CC1(C)OB(OC1(C)C)c1cc2ccccc2n1S(=O)(=O)c1ccccc1 | 100mg | 742299535
eMolecules 1256345-59-1 | 4-bromo-3-methoxyphenylboronic acid | Combi-Blocks | MFCD16036103 | 230.850 | C7H8BBrO3 | 98.000 | COc1cc(ccc1Br)B(O)O | 1g | 117521469
4-bromo-3-methoxyphenylboronic acid | Combi-Blocks | 1256345-59-1 | MFCD16036103 | 230.850 | C7H8BBrO3 | 98.000 | COc1cc(ccc1Br)B(O)O | 1g | 117521469